C12H17BrN2O2S3 — CID 61458044
2-[(3-bromothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide (PubChem CID 61458044) has the molecular formula C12H17BrN2O2S3 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide |
|---|---|
| PubChem CID | 61458044 |
| Molecular Formula | C12H17BrN2O2S3 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide |
| SMILES | NC(=S)C(NS(=O)(=O)c1sccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C12H17BrN2O2S3/c13-9-6-7-19-12(9)20(16,17)15-10(11(14)18)8-4-2-1-3-5-8/h6-8,10,15H,1-5H2,(H2,14,18) |
| InChIKey | PMFFTADNKCLBBO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|