C9H13BrN2O2S2 — CID 115301357
N-(2-amino-2-cyclopropylethyl)-3-bromothiophene-2-sulfonamide (PubChem CID 115301357) has the molecular formula C9H13BrN2O2S2 and a molecular weight of 325.25 g/mol. Its IUPAC name is N-(2-amino-2-cyclopropylethyl)-3-bromothiophene-2-sulfonamide.
| Compound Name | N-(2-amino-2-cyclopropylethyl)-3-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115301357 |
| Molecular Formula | C9H13BrN2O2S2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | N-(2-amino-2-cyclopropylethyl)-3-bromothiophene-2-sulfonamide |
| SMILES | NC(CNS(=O)(=O)c1sccc1Br)C1CC1 |
| InChI | InChI=1S/C9H13BrN2O2S2/c10-7-3-4-15-9(7)16(13,14)12-5-8(11)6-1-2-6/h3-4,6,8,12H,1-2,5,11H2 |
| InChIKey | OOJPNXHMHCHRLM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |