C10H17BrN2O2S2 — CID 84591422
N-(2-amino-2-ethylbutyl)-3-bromothiophene-2-sulfonamide (PubChem CID 84591422) has the molecular formula C10H17BrN2O2S2 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-bromothiophene-2-sulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 84591422 |
| Molecular Formula | C10H17BrN2O2S2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-bromothiophene-2-sulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H17BrN2O2S2/c1-3-10(12,4-2)7-13-17(14,15)9-8(11)5-6-16-9/h5-6,13H,3-4,7,12H2,1-2H3 |
| InChIKey | SZPFPNLWJAQPOH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |