C12H19BrN2O3S2 — CID 61072491
3-bromo-N-(2-methyl-2-morpholin-4-ylpropyl)thiophene-2-sulfonamide (PubChem CID 61072491) has the molecular formula C12H19BrN2O3S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 3-bromo-N-(2-methyl-2-morpholin-4-ylpropyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(2-methyl-2-morpholin-4-ylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61072491 |
| Molecular Formula | C12H19BrN2O3S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 3-bromo-N-(2-methyl-2-morpholin-4-ylpropyl)thiophene-2-sulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)c1sccc1Br)N1CCOCC1 |
| InChI | InChI=1S/C12H19BrN2O3S2/c1-12(2,15-4-6-18-7-5-15)9-14-20(16,17)11-10(13)3-8-19-11/h3,8,14H,4-7,9H2,1-2H3 |
| InChIKey | PIROZPSMEFLBON-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |