C12H19BrN2O2S2 — CID 115309366
N-(2-amino-1-cyclohexylethyl)-3-bromothiophene-2-sulfonamide (PubChem CID 115309366) has the molecular formula C12H19BrN2O2S2 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-3-bromothiophene-2-sulfonamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-3-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115309366 |
| Molecular Formula | C12H19BrN2O2S2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-3-bromothiophene-2-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1sccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C12H19BrN2O2S2/c13-10-6-7-18-12(10)19(16,17)15-11(8-14)9-4-2-1-3-5-9/h6-7,9,11,15H,1-5,8,14H2 |
| InChIKey | JFQANLCHFRAYGP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |