C10H17BrN2O2S2 — CID 97225503
N-[(2S)-1-aminohexan-2-yl]-3-bromothiophene-2-sulfonamide (PubChem CID 97225503) has the molecular formula C10H17BrN2O2S2 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[(2S)-1-aminohexan-2-yl]-3-bromothiophene-2-sulfonamide.
| Compound Name | N-[(2S)-1-aminohexan-2-yl]-3-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 97225503 |
| Molecular Formula | C10H17BrN2O2S2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-[(2S)-1-aminohexan-2-yl]-3-bromothiophene-2-sulfonamide |
| SMILES | CCCC[C@@H](CN)NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H17BrN2O2S2/c1-2-3-4-8(7-12)13-17(14,15)10-9(11)5-6-16-10/h5-6,8,13H,2-4,7,12H2,1H3/t8-/m0/s1 |
| InChIKey | BLGBUWZOXSVULK-QMMMGPOBSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |