C11H14BrNO2S2 — CID 103838056
3-bromo-N-[(1-cyclopropylcyclopropyl)methyl]thiophene-2-sulfonamide (PubChem CID 103838056) has the molecular formula C11H14BrNO2S2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 3-bromo-N-[(1-cyclopropylcyclopropyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[(1-cyclopropylcyclopropyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103838056 |
| Molecular Formula | C11H14BrNO2S2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 3-bromo-N-[(1-cyclopropylcyclopropyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1(C2CC2)CC1)c1sccc1Br |
| InChI | InChI=1S/C11H14BrNO2S2/c12-9-3-6-16-10(9)17(14,15)13-7-11(4-5-11)8-1-2-8/h3,6,8,13H,1-2,4-5,7H2 |
| InChIKey | DFUITGQMIQAPIU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |