C11H15Br2NO2S2 — CID 113271024
3-bromo-N-[1-(bromomethyl)cyclohexyl]thiophene-2-sulfonamide (PubChem CID 113271024) has the molecular formula C11H15Br2NO2S2 and a molecular weight of 417.19 g/mol. Its IUPAC name is 3-bromo-N-[1-(bromomethyl)cyclohexyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[1-(bromomethyl)cyclohexyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113271024 |
| Molecular Formula | C11H15Br2NO2S2 |
| Molecular Weight | 417.19 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | 3-bromo-N-[1-(bromomethyl)cyclohexyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1(CBr)CCCCC1)c1sccc1Br |
| InChI | InChI=1S/C11H15Br2NO2S2/c12-8-11(5-2-1-3-6-11)14-18(15,16)10-9(13)4-7-17-10/h4,7,14H,1-3,5-6,8H2 |
| InChIKey | DJXGWXYCEZIANI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|