C11H13Br2NOS — CID 114311405
3-bromo-N-[1-(bromomethyl)cyclopentyl]thiophene-2-carboxamide (PubChem CID 114311405) has the molecular formula C11H13Br2NOS and a molecular weight of 367.11 g/mol. Its IUPAC name is 3-bromo-N-[1-(bromomethyl)cyclopentyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[1-(bromomethyl)cyclopentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114311405 |
| Molecular Formula | C11H13Br2NOS |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | 3-bromo-N-[1-(bromomethyl)cyclopentyl]thiophene-2-carboxamide |
| SMILES | O=C(NC1(CBr)CCCC1)c1sccc1Br |
| InChI | InChI=1S/C11H13Br2NOS/c12-7-11(4-1-2-5-11)14-10(15)9-8(13)3-6-16-9/h3,6H,1-2,4-5,7H2,(H,14,15) |
| InChIKey | OUORKOVBEPHZEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|