C11H13Br2NO2S — CID 106300923
3-bromo-N-[4-(bromomethyl)oxan-4-yl]thiophene-2-carboxamide (PubChem CID 106300923) has the molecular formula C11H13Br2NO2S and a molecular weight of 383.11 g/mol. Its IUPAC name is 3-bromo-N-[4-(bromomethyl)oxan-4-yl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[4-(bromomethyl)oxan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106300923 |
| Molecular Formula | C11H13Br2NO2S |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | 3-bromo-N-[4-(bromomethyl)oxan-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1(CBr)CCOCC1)c1sccc1Br |
| InChI | InChI=1S/C11H13Br2NO2S/c12-7-11(2-4-16-5-3-11)14-10(15)9-8(13)1-6-17-9/h1,6H,2-5,7H2,(H,14,15) |
| InChIKey | LDHWHQLIEFFEQA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|