C11H14BrCl2NO2S2 — CID 114293762
N-[1-(bromomethyl)cyclohexyl]-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 114293762) has the molecular formula C11H14BrCl2NO2S2 and a molecular weight of 407.18 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclohexyl]-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-[1-(bromomethyl)cyclohexyl]-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114293762 |
| Molecular Formula | C11H14BrCl2NO2S2 |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | N-[1-(bromomethyl)cyclohexyl]-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1(CBr)CCCCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H14BrCl2NO2S2/c12-7-11(4-2-1-3-5-11)15-19(16,17)8-6-9(13)18-10(8)14/h6,15H,1-5,7H2 |
| InChIKey | DFPVKZAZGHVJKE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|