C12H17Br2NO2S2 — CID 103969987
3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]thiophene-2-sulfonamide (PubChem CID 103969987) has the molecular formula C12H17Br2NO2S2 and a molecular weight of 431.22 g/mol. Its IUPAC name is 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103969987 |
| Molecular Formula | C12H17Br2NO2S2 |
| Molecular Weight | 431.22 g/mol |
| Exact Mass | 428.91 |
| IUPAC Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1(CBr)CCCCC1)c1sccc1Br |
| InChI | InChI=1S/C12H17Br2NO2S2/c13-8-12(5-2-1-3-6-12)9-15-19(16,17)11-10(14)4-7-18-11/h4,7,15H,1-3,5-6,8-9H2 |
| InChIKey | AEJTTXHLMMJMPO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|