C14H18Br2ClNO2S — CID 106613159
3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-4-chlorobenzenesulfonamide (PubChem CID 106613159) has the molecular formula C14H18Br2ClNO2S and a molecular weight of 459.63 g/mol. Its IUPAC name is 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-4-chlorobenzenesulfonamide.
| Compound Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106613159 |
| Molecular Formula | C14H18Br2ClNO2S |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1(CBr)CCCCC1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H18Br2ClNO2S/c15-9-14(6-2-1-3-7-14)10-18-21(19,20)11-4-5-13(17)12(16)8-11/h4-5,8,18H,1-3,6-7,9-10H2 |
| InChIKey | RDWFFDSFIBLQDA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|