C10H14BrNO3S2 — CID 103835912
3-bromo-N-[2-(hydroxymethyl)cyclopentyl]thiophene-2-sulfonamide (PubChem CID 103835912) has the molecular formula C10H14BrNO3S2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 3-bromo-N-[2-(hydroxymethyl)cyclopentyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[2-(hydroxymethyl)cyclopentyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103835912 |
| Molecular Formula | C10H14BrNO3S2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 3-bromo-N-[2-(hydroxymethyl)cyclopentyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1CO)c1sccc1Br |
| InChI | InChI=1S/C10H14BrNO3S2/c11-8-4-5-16-10(8)17(14,15)12-9-3-1-2-7(9)6-13/h4-5,7,9,12-13H,1-3,6H2 |
| InChIKey | WRSVEMVPZJJWQO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |