C10H13BrClNO3S2 — CID 115685447
5-bromo-4-chloro-N-[1-(oxolan-3-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 115685447) has the molecular formula C10H13BrClNO3S2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[1-(oxolan-3-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[1-(oxolan-3-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115685447 |
| Molecular Formula | C10H13BrClNO3S2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 5-bromo-4-chloro-N-[1-(oxolan-3-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)c(Br)s1)C1CCOC1 |
| InChI | InChI=1S/C10H13BrClNO3S2/c1-6(7-2-3-16-5-7)13-18(14,15)9-4-8(12)10(11)17-9/h4,6-7,13H,2-3,5H2,1H3 |
| InChIKey | WNNJKGQYVJBHQO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |