C13H15ClN2O3S — CID 115650641
3-chloro-4-cyano-N-[1-(oxolan-3-yl)ethyl]benzenesulfonamide (PubChem CID 115650641) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[1-(oxolan-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[1-(oxolan-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115650641 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-chloro-4-cyano-N-[1-(oxolan-3-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(C#N)c(Cl)c1)C1CCOC1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-9(11-4-5-19-8-11)16-20(17,18)12-3-2-10(7-15)13(14)6-12/h2-3,6,9,11,16H,4-5,8H2,1H3 |
| InChIKey | UGUBPFVUHJLTJO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |