C12H16FNO5S2 — CID 114958508
3-[1-(oxolan-3-yl)ethylsulfamoyl]benzenesulfonyl fluoride (PubChem CID 114958508) has the molecular formula C12H16FNO5S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-[1-(oxolan-3-yl)ethylsulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[1-(oxolan-3-yl)ethylsulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958508 |
| Molecular Formula | C12H16FNO5S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-[1-(oxolan-3-yl)ethylsulfamoyl]benzenesulfonyl fluoride |
| SMILES | CC(NS(=O)(=O)c1cccc(S(=O)(=O)F)c1)C1CCOC1 |
| InChI | InChI=1S/C12H16FNO5S2/c1-9(10-5-6-19-8-10)14-21(17,18)12-4-2-3-11(7-12)20(13,15)16/h2-4,7,9-10,14H,5-6,8H2,1H3 |
| InChIKey | IEIVFAJOKPYZBU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |