C16H19NO3S — CID 115684208
N-[1-(oxolan-3-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 115684208) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[1-(oxolan-3-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[1-(oxolan-3-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 115684208 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[1-(oxolan-3-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc2ccccc12)C1CCOC1 |
| InChI | InChI=1S/C16H19NO3S/c1-12(14-9-10-20-11-14)17-21(18,19)16-8-4-6-13-5-2-3-7-15(13)16/h2-8,12,14,17H,9-11H2,1H3 |
| InChIKey | IVNNIZOYVSWAFV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |