C17H24N2O4S — CID 100624397
3-(cyclopropylmethylsulfamoyl)-N-[(1R)-1-[(3R)-oxolan-3-yl]ethyl]benzamide (PubChem CID 100624397) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-[(1R)-1-[(3R)-oxolan-3-yl]ethyl]benzamide.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-[(1R)-1-[(3R)-oxolan-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 100624397 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-[(1R)-1-[(3R)-oxolan-3-yl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(S(=O)(=O)NCC2CC2)c1)[C@H]1CCOC1 |
| InChI | InChI=1S/C17H24N2O4S/c1-12(15-7-8-23-11-15)19-17(20)14-3-2-4-16(9-14)24(21,22)18-10-13-5-6-13/h2-4,9,12-13,15,18H,5-8,10-11H2,1H3,(H,19,20)/t12-,15+/m1/s1 |
| InChIKey | LCINMGIKFIUTFJ-DOMZBBRYSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |