C14H17NO4 — CID 124595766
3-[[(1R)-1-[(3R)-oxolan-3-yl]ethyl]carbamoyl]benzoic acid (PubChem CID 124595766) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[[(1R)-1-[(3R)-oxolan-3-yl]ethyl]carbamoyl]benzoic acid.
| Compound Name | 3-[[(1R)-1-[(3R)-oxolan-3-yl]ethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 124595766 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[[(1R)-1-[(3R)-oxolan-3-yl]ethyl]carbamoyl]benzoic acid |
| SMILES | C[C@@H](NC(=O)c1cccc(C(=O)O)c1)[C@H]1CCOC1 |
| InChI | InChI=1S/C14H17NO4/c1-9(12-5-6-19-8-12)15-13(16)10-3-2-4-11(7-10)14(17)18/h2-4,7,9,12H,5-6,8H2,1H3,(H,15,16)(H,17,18)/t9-,12+/m1/s1 |
| InChIKey | ZWWFFGRRVJKEMD-SKDRFNHKSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |