C11H14INO2S — CID 115648944
5-iodo-N-[1-(oxolan-3-yl)ethyl]thiophene-3-carboxamide (PubChem CID 115648944) has the molecular formula C11H14INO2S and a molecular weight of 351.21 g/mol. Its IUPAC name is 5-iodo-N-[1-(oxolan-3-yl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[1-(oxolan-3-yl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115648944 |
| Molecular Formula | C11H14INO2S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 5-iodo-N-[1-(oxolan-3-yl)ethyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)c1csc(I)c1)C1CCOC1 |
| InChI | InChI=1S/C11H14INO2S/c1-7(8-2-3-15-5-8)13-11(14)9-4-10(12)16-6-9/h4,6-8H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | NUHQKTUXHZMGCU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|