C17H22N2O5S — CID 120692396
(E)-2-[[3-(cyclopropylmethylsulfamoyl)benzoyl]amino]hex-4-enoic acid (PubChem CID 120692396) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is (E)-2-[[3-(cyclopropylmethylsulfamoyl)benzoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[3-(cyclopropylmethylsulfamoyl)benzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692396 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (E)-2-[[3-(cyclopropylmethylsulfamoyl)benzoyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cccc(S(=O)(=O)NCC2CC2)c1)C(=O)O |
| InChI | InChI=1S/C17H22N2O5S/c1-2-3-7-15(17(21)22)19-16(20)13-5-4-6-14(10-13)25(23,24)18-11-12-8-9-12/h2-6,10,12,15,18H,7-9,11H2,1H3,(H,19,20)(H,21,22)/b3-2+ |
| InChIKey | KYGZXOKUZNHETL-NSCUHMNNSA-N |
| XLogP | 1.52 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|