C16H20N2O5S — CID 120693808
(E)-2-[[4-(prop-2-enylsulfamoyl)benzoyl]amino]hex-4-enoic acid (PubChem CID 120693808) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is (E)-2-[[4-(prop-2-enylsulfamoyl)benzoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[4-(prop-2-enylsulfamoyl)benzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693808 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (E)-2-[[4-(prop-2-enylsulfamoyl)benzoyl]amino]hex-4-enoic acid |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NC(C/C=C/C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-5-6-14(16(20)21)18-15(19)12-7-9-13(10-8-12)24(22,23)17-11-4-2/h3-5,7-10,14,17H,2,6,11H2,1H3,(H,18,19)(H,20,21)/b5-3+ |
| InChIKey | OUKBSBZRLBSNTF-HWKANZROSA-N |
| XLogP | 1.30 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|