C16H21NO3S — CID 120693890
(E)-2-[[4-(ethylsulfanylmethyl)benzoyl]amino]hex-4-enoic acid (PubChem CID 120693890) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is (E)-2-[[4-(ethylsulfanylmethyl)benzoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[4-(ethylsulfanylmethyl)benzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693890 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (E)-2-[[4-(ethylsulfanylmethyl)benzoyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(CSCC)cc1)C(=O)O |
| InChI | InChI=1S/C16H21NO3S/c1-3-5-6-14(16(19)20)17-15(18)13-9-7-12(8-10-13)11-21-4-2/h3,5,7-10,14H,4,6,11H2,1-2H3,(H,17,18)(H,19,20)/b5-3+ |
| InChIKey | TWKZFSZRBGHWLM-HWKANZROSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|