C18H20N2O5 — CID 120693039
(E)-2-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]hex-4-enoic acid (PubChem CID 120693039) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (E)-2-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693039 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (E)-2-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(CC2CC(=O)NC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c1-2-3-4-14(18(24)25)19-16(22)12-7-5-11(6-8-12)9-13-10-15(21)20-17(13)23/h2-3,5-8,13-14H,4,9-10H2,1H3,(H,19,22)(H,24,25)(H,20,21,23)/b3-2+ |
| InChIKey | AIQYSXGPACKUJX-NSCUHMNNSA-N |
| XLogP | 1.04 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|