C18H23N3O3 — CID 120553759
4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide (PubChem CID 120553759) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 120553759 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide |
| SMILES | CC1CNCCC1NC(=O)c1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-11-10-19-7-6-15(11)20-17(23)13-4-2-12(3-5-13)8-14-9-16(22)21-18(14)24/h2-5,11,14-15,19H,6-10H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | WMRYULJRBLWBDP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|