C18H26ClN3O3 — CID 119607207
N-(1-amino-2,3-dimethylbutan-2-yl)-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride (PubChem CID 119607207) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119607207 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc(CC2CC(=O)NC2=O)cc1.Cl |
| InChI | InChI=1S/C18H25N3O3.ClH/c1-11(2)18(3,10-19)21-17(24)13-6-4-12(5-7-13)8-14-9-15(22)20-16(14)23;/h4-7,11,14H,8-10,19H2,1-3H3,(H,21,24)(H,20,22,23);1H |
| InChIKey | OEUCYVXAIMHJQT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|