C22H22N2O5 — CID 119201378
4-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]-4-phenylbutanoic acid (PubChem CID 119201378) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 4-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201378 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-[[4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzoyl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc(CC2CC(=O)NC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c25-19-13-17(22(29)24-19)12-14-6-8-16(9-7-14)21(28)23-18(10-11-20(26)27)15-4-2-1-3-5-15/h1-9,17-18H,10-13H2,(H,23,28)(H,26,27)(H,24,25,29) |
| InChIKey | BKJPDZMFUXAARC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|