C21H30ClN3O3 — CID 119620286
N-[2-(cycloheptylamino)ethyl]-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride (PubChem CID 119620286) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119620286 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4-[(2,5-dioxopyrrolidin-3-yl)methyl]benzamide;hydrochloride |
| SMILES | Cl.O=C1CC(Cc2ccc(C(=O)NCCNC3CCCCCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H29N3O3.ClH/c25-19-14-17(21(27)24-19)13-15-7-9-16(10-8-15)20(26)23-12-11-22-18-5-3-1-2-4-6-18;/h7-10,17-18,22H,1-6,11-14H2,(H,23,26)(H,24,25,27);1H |
| InChIKey | OGABCIIDQRHSBL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|