C16H21N3O3 — CID 119332298
(2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-3-methylbutanamide (PubChem CID 119332298) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 119332298 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)Nc1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-9(2)14(17)16(22)18-12-5-3-10(4-6-12)7-11-8-13(20)19-15(11)21/h3-6,9,11,14H,7-8,17H2,1-2H3,(H,18,22)(H,19,20,21)/t11?,14-/m0/s1 |
| InChIKey | FCTXBQWVRORJCL-IAXJKZSUSA-N |
| XLogP | 0.81 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|