C20H17N3O3 — CID 98182970
N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-1H-indole-6-carboxamide (PubChem CID 98182970) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-1H-indole-6-carboxamide.
| Compound Name | N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 98182970 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-1H-indole-6-carboxamide |
| SMILES | O=C1C[C@H](Cc2ccc(NC(=O)c3ccc4cc[nH]c4c3)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H17N3O3/c24-18-11-15(20(26)23-18)9-12-1-5-16(6-2-12)22-19(25)14-4-3-13-7-8-21-17(13)10-14/h1-8,10,15,21H,9,11H2,(H,22,25)(H,23,24,26)/t15-/m0/s1 |
| InChIKey | YAAWXLDHMBXXMK-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|