C20H20N2O3 — CID 68698623
tert-butyl 4-(1H-indole-6-carbonylamino)benzoate (PubChem CID 68698623) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl 4-(1H-indole-6-carbonylamino)benzoate.
| Compound Name | tert-butyl 4-(1H-indole-6-carbonylamino)benzoate |
|---|---|
| PubChem CID | 68698623 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | tert-butyl 4-(1H-indole-6-carbonylamino)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)c2ccc3cc[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-20(2,3)25-19(24)14-6-8-16(9-7-14)22-18(23)15-5-4-13-10-11-21-17(13)12-15/h4-12,21H,1-3H3,(H,22,23) |
| InChIKey | CHTCPVCTBOXIDH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |