C19H17FN2O3 — CID 98518315
N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-fluoro-4-methylbenzamide (PubChem CID 98518315) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 98518315 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C[C@H]3CC(=O)NC3=O)cc2)cc1F |
| InChI | InChI=1S/C19H17FN2O3/c1-11-2-5-13(9-16(11)20)18(24)21-15-6-3-12(4-7-15)8-14-10-17(23)22-19(14)25/h2-7,9,14H,8,10H2,1H3,(H,21,24)(H,22,23,25)/t14-/m0/s1 |
| InChIKey | VTSWZFWASIIPLV-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|