C15H14Cl2N2O3 — CID 95774363
(1S)-2,2-dichloro-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 95774363) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95774363 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (1S)-2,2-dichloro-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C1C[C@@H](Cc2ccc(NC(=O)[C@@H]3CC3(Cl)Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c16-15(17)7-11(15)14(22)18-10-3-1-8(2-4-10)5-9-6-12(20)19-13(9)21/h1-4,9,11H,5-7H2,(H,18,22)(H,19,20,21)/t9-,11+/m1/s1 |
| InChIKey | UAMDIMDZHNTEHN-KOLCDFICSA-N |
| XLogP | 2.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|