C19H26N2O4 — CID 98182993
(2S)-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-2-(3-methylbutoxy)propanamide (PubChem CID 98182993) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2S)-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-2-(3-methylbutoxy)propanamide.
| Compound Name | (2S)-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-2-(3-methylbutoxy)propanamide |
|---|---|
| PubChem CID | 98182993 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2S)-N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-2-(3-methylbutoxy)propanamide |
| SMILES | CC(C)CCO[C@@H](C)C(=O)Nc1ccc(C[C@@H]2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-12(2)8-9-25-13(3)18(23)20-16-6-4-14(5-7-16)10-15-11-17(22)21-19(15)24/h4-7,12-13,15H,8-11H2,1-3H3,(H,20,23)(H,21,22,24)/t13-,15+/m0/s1 |
| InChIKey | CCSWWVWDKAIBQH-DZGCQCFKSA-N |
| XLogP | 2.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|