C17H23N3O3 — CID 119798822
(2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-methylpentanamide (PubChem CID 119798822) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119798822 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-10(2)7-14(18)17(23)19-13-5-3-11(4-6-13)8-12-9-15(21)20-16(12)22/h3-6,10,12,14H,7-9,18H2,1-2H3,(H,19,23)(H,20,21,22)/t12?,14-/m0/s1 |
| InChIKey | JKCKACIBPGWRDG-PYMCNQPYSA-N |
| XLogP | 1.20 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|