C19H17FN2O3 — CID 56794258
N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-5-fluoro-2-methylbenzamide (PubChem CID 56794258) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-5-fluoro-2-methylbenzamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 56794258 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)Nc1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C19H17FN2O3/c1-11-2-5-14(20)10-16(11)19(25)21-15-6-3-12(4-7-15)8-13-9-17(23)22-18(13)24/h2-7,10,13H,8-9H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | WJWIQWIEWQOWCO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|