C18H23N3O4 — CID 120794532
2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 120794532) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120794532 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-amino-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)Nc1ccc(CC2CC(=O)NC2=O)cc1)C1CCOCC1 |
| InChI | InChI=1S/C18H23N3O4/c19-16(12-5-7-25-8-6-12)18(24)20-14-3-1-11(2-4-14)9-13-10-15(22)21-17(13)23/h1-4,12-13,16H,5-10,19H2,(H,20,24)(H,21,22,23) |
| InChIKey | XFITZJOQMHUCCO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|