C19H31Cl2N3O3 — CID 120798857
2-amino-N-[4-(2-morpholin-4-ylethyl)phenyl]-2-(oxan-4-yl)acetamide;dihydrochloride (PubChem CID 120798857) has the molecular formula C19H31Cl2N3O3 and a molecular weight of 420.38 g/mol. Its IUPAC name is 2-amino-N-[4-(2-morpholin-4-ylethyl)phenyl]-2-(oxan-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[4-(2-morpholin-4-ylethyl)phenyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120798857 |
| Molecular Formula | C19H31Cl2N3O3 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-amino-N-[4-(2-morpholin-4-ylethyl)phenyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)Nc1ccc(CCN2CCOCC2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C19H29N3O3.2ClH/c20-18(16-6-11-24-12-7-16)19(23)21-17-3-1-15(2-4-17)5-8-22-9-13-25-14-10-22;;/h1-4,16,18H,5-14,20H2,(H,21,23);2*1H |
| InChIKey | OURBCNDJRATZPT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |