C17H18N4O3S — CID 120635216
2-(2-aminoethyl)-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 120635216) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120635216 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(2-aminoethyl)-N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2ccc(CC3CC(=O)NC3=O)cc2)cs1 |
| InChI | InChI=1S/C17H18N4O3S/c18-6-5-15-20-13(9-25-15)17(24)19-12-3-1-10(2-4-12)7-11-8-14(22)21-16(11)23/h1-4,9,11H,5-8,18H2,(H,19,24)(H,21,22,23) |
| InChIKey | JVVIBKSWSSLDRB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|