C13H13N5OS — CID 66390803
2-(2-aminoethyl)-N-(1H-indazol-6-yl)-1,3-thiazole-4-carboxamide (PubChem CID 66390803) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(1H-indazol-6-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-(1H-indazol-6-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66390803 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(2-aminoethyl)-N-(1H-indazol-6-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2ccc3cn[nH]c3c2)cs1 |
| InChI | InChI=1S/C13H13N5OS/c14-4-3-12-17-11(7-20-12)13(19)16-9-2-1-8-6-15-18-10(8)5-9/h1-2,5-7H,3-4,14H2,(H,15,18)(H,16,19) |
| InChIKey | PWTMSKDMBHLNKH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |