C17H21NO3 — CID 120694214
(E)-2-[(4-cyclobutylbenzoyl)amino]hex-4-enoic acid (PubChem CID 120694214) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (E)-2-[(4-cyclobutylbenzoyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(4-cyclobutylbenzoyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694214 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (E)-2-[(4-cyclobutylbenzoyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(C2CCC2)cc1)C(=O)O |
| InChI | InChI=1S/C17H21NO3/c1-2-3-7-15(17(20)21)18-16(19)14-10-8-13(9-11-14)12-5-4-6-12/h2-3,8-12,15H,4-7H2,1H3,(H,18,19)(H,20,21)/b3-2+ |
| InChIKey | OMWRYIINEKZYKN-NSCUHMNNSA-N |
| XLogP | 3.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|