C15H23N3O3S — CID 120653889
N-[(2R)-2-(ethylamino)propyl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 120653889) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 120653889 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NC[C@@H](C)NCC)cc1 |
| InChI | InChI=1S/C15H23N3O3S/c1-4-10-18-22(20,21)14-8-6-13(7-9-14)15(19)17-11-12(3)16-5-2/h4,6-9,12,16,18H,1,5,10-11H2,2-3H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | HCZDMCLVSMEWMT-GFCCVEGCSA-N |
| XLogP | 0.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|