C11H11ClN2O3S — CID 112703665
3-chloro-4-cyano-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 112703665) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 112703665 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-chloro-4-cyano-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2CCOC2)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O3S/c12-11-5-10(2-1-8(11)6-13)18(15,16)14-9-3-4-17-7-9/h1-2,5,9,14H,3-4,7H2 |
| InChIKey | ARLNGGOBYACHRP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |