C14H19BrClNO2S — CID 79872495
4-bromo-2-chloro-N-(2,2-dimethylcyclohexyl)benzenesulfonamide (PubChem CID 79872495) has the molecular formula C14H19BrClNO2S and a molecular weight of 380.74 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2,2-dimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(2,2-dimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79872495 |
| Molecular Formula | C14H19BrClNO2S |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 4-bromo-2-chloro-N-(2,2-dimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1(C)CCCCC1NS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H19BrClNO2S/c1-14(2)8-4-3-5-13(14)17-20(18,19)12-7-6-10(15)9-11(12)16/h6-7,9,13,17H,3-5,8H2,1-2H3 |
| InChIKey | MCIWAQZAYVQADB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |