C11H23NO2S — CID 58431850
N-[(1S,2R)-2-tert-butylcyclohexyl]methanesulfonamide (PubChem CID 58431850) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is N-[(1S,2R)-2-tert-butylcyclohexyl]methanesulfonamide.
| Compound Name | N-[(1S,2R)-2-tert-butylcyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 58431850 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[(1S,2R)-2-tert-butylcyclohexyl]methanesulfonamide |
| SMILES | CC(C)(C)[C@H]1CCCC[C@@H]1NS(C)(=O)=O |
| InChI | InChI=1S/C11H23NO2S/c1-11(2,3)9-7-5-6-8-10(9)12-15(4,13)14/h9-10,12H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | NPEKXVTWBDQQLV-UWVGGRQHSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |