C6H12FNO2S — CID 130766267
N-[(1R,2S)-2-fluorocyclopentyl]methanesulfonamide (PubChem CID 130766267) has the molecular formula C6H12FNO2S and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[(1R,2S)-2-fluorocyclopentyl]methanesulfonamide.
| Compound Name | N-[(1R,2S)-2-fluorocyclopentyl]methanesulfonamide |
|---|---|
| PubChem CID | 130766267 |
| Molecular Formula | C6H12FNO2S |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | N-[(1R,2S)-2-fluorocyclopentyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCC[C@@H]1F |
| InChI | InChI=1S/C6H12FNO2S/c1-11(9,10)8-6-4-2-3-5(6)7/h5-6,8H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | QSROEFPOKBJRTO-NTSWFWBYSA-N |
| XLogP | 0.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |