C10H22ClN3O3S — CID 119821597
N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119821597) has the molecular formula C10H22ClN3O3S and a molecular weight of 299.82 g/mol. Its IUPAC name is N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119821597 |
| Molecular Formula | C10H22ClN3O3S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NCC1CCCC1NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C10H21N3O3S.ClH/c1-11-7-10(14)12-6-8-4-3-5-9(8)13-17(2,15)16;/h8-9,11,13H,3-7H2,1-2H3,(H,12,14);1H |
| InChIKey | SMIFEOIPFYKXHY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |