C13H28ClN3O3S — CID 119821615
2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-3-methylpentanamide;hydrochloride (PubChem CID 119821615) has the molecular formula C13H28ClN3O3S and a molecular weight of 341.91 g/mol. Its IUPAC name is 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119821615 |
| Molecular Formula | C13H28ClN3O3S |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NCC1CCCC1NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C13H27N3O3S.ClH/c1-4-9(2)12(14)13(17)15-8-10-6-5-7-11(10)16-20(3,18)19;/h9-12,16H,4-8,14H2,1-3H3,(H,15,17);1H |
| InChIKey | BJNMRSNRRWSELW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |