C13H27N3O3S — CID 119821628
2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-methylpentanamide (PubChem CID 119821628) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-methylpentanamide.
| Compound Name | 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 119821628 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2-amino-N-[[2-(methanesulfonamido)cyclopentyl]methyl]-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)NCC1CCCC1NS(C)(=O)=O |
| InChI | InChI=1S/C13H27N3O3S/c1-4-8-13(2,14)12(17)15-9-10-6-5-7-11(10)16-20(3,18)19/h10-11,16H,4-9,14H2,1-3H3,(H,15,17) |
| InChIKey | CPPGSSHUDSHHAE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |